WikipediaCAS 134-03-2
Live English Wikipedia chembox and article.
Wikipedia chembox
| Names | |
|---|---|
| IUPAC name | Sodium (2 R )-2-[(1 S )-1,2-dihydroxyethyl]-4-hydroxy-5-oxo-2 H -furan-3-olate |
| Other names | Sodascorbate; Monosodium ascorbate; E301 |
| Identifiers | |
| CAS Number | 134-03-2 |
| ChemSpider | 16736174 |
| DrugBank | DB14482 |
| EC Number | 205-126-1 |
| E number | E301 (antioxidants, ...) |
| PubChem CID | 23667548 |
| RTECS number | CI7671000 |
| InChI | Key: PPASLZSBLFJQEF-RXSVEWSESA-M · InChI=1S/C6H8O6.Na/c7-1-2(8)5-3(9)4(10)6(11)12-5;/h2,5,7-10H, 1H2;/q;+1/p-1/t2-,5+;/m0./s1 |
| SMILES | OC1=C([O-])[C@]([C@@H](O)CO)([H])OC1=O.[Na+] |
| Properties | |
| Chemical formula | C 6 H 7 Na O 6 |
| Molar mass | 198.106 g · mol−1 |
| Appearance | minute white to yellow crystals |
| Odor | odorless |
| Density | 1.66 g/cm3 |
| Melting point | 218 °C (424 °F; 491 K) (decomposes) |
| Solubility in water | 62 g/100 mL (25 °C) / 78 g/100 mL (75 °C) |
| Solubility | very slightly soluble in alcohol / insoluble in chloroform , ether |
Wikipedia
Chemical compound
Sodium ascorbate is one of a number of mineral salts of ascorbic acid (vitamin C). The molecular formula of this chemical compound is C6H7NaO6. As the sodium salt of ascorbic acid, it is known as a mineral ascorbate. It has not been demonstrated to be more bioavailable than any other form of vitamin C supplement.