WikipediaCAS 330-55-2
Live English Wikipedia chembox and article.
Wikipedia chembox
| Identifiers | |
|---|---|
| IUPAC name | N' -(3,4-dichlorophenyl)- N -methoxy- N -methylurea |
| CAS Number | 330-55-2 |
| PubChem CID | 9502 |
| ChemSpider | 9130 |
| UNII | 01XP1SU59O |
| Chemical and physical data | |
| Formula | C 9 H 10 Cl 2 N 2 O 2 |
| Molar mass | 249.09 g · mol−1 |
| 3D model ( JSmol ) | |
| Density | 1.49 g/cm3 |
| Melting point | 93 to 95 °C (199 to 203 °F) |
| SMILES | CON(C)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H10Cl2N2O2/c1-13(15-2)9(14)12-6-3-4-7(10)8(11)5-6/h3-5H,1-2H3,(H,12,14) · Key:XKJMBINCVNINCA-UHFFFAOYSA-N |
Wikipedia
Herbicide
Linuron is a phenylurea herbicide that is used to control the growth of grass and weeds for the purpose of supporting the growth of crops like soybeans. It is registered for use in India.