WikipediaCAS 91-53-2
Live English Wikipedia chembox and article.
Wikipedia chembox
| Names | |
|---|---|
| Preferred IUPAC name | 6-Ethoxy-2,2,4-trimethyl-1,2-dihydroquinoline |
| Identifiers | |
| CAS Number | 91-53-2 |
| E number | E324 (antioxidants, ...) |
| PubChem CID | 3293 |
| SMILES | O(c2ccc1c(\C(=C/C(N1)(C)C)C)c2)CC |
| Properties | |
| Chemical formula | C 14 H 19 N O |
| Molar mass | 217.312 g · mol−1 |
| Melting point | < 25 °C (77 °F; 298 K) |
| Boiling point | 123–125 °C (253–257 °F; 396–398 K) at 2 mmHg |
Wikipedia
Chemical compound
Ethoxyquin (EMQ) is a quinoline-based antioxidant used as a food preservative in certain countries and originally to control scald on pears after harvest. It is used as a preservative in some pet foods to slow the development of rancidity of fats. Ethoxyquin is also used in some spices to prevent color loss due to oxidation of the natural carotenoid pigments. It has been used as a fire retardant for fish meal since the 1960s.