WikipediaCAS 97-23-4
Live English Wikipedia chembox and article.
Wikipedia chembox
| Clinical data | |
|---|---|
| AHFS / Drugs.com | International Drug Names |
| ATC code | P02DX02 ( WHO ) |
| Identifiers | |
| IUPAC name | 4-Chloro-2-[(5-chloro-2-hydroxyphenyl)methyl]phenol |
| CAS Number | 97-23-4 |
| PubChem CID | 3037 |
| UNII | T1J0JOU64O |
| Chemical and physical data | |
| Formula | C 13 H 10 Cl 2 O 2 |
| Molar mass | 269.12 g · mol−1 |
| 3D model ( JSmol ) | |
| Density | 1.5 g/cm3 g/cm3 |
| Melting point | 177.5 °C (351.5 °F) |
| Solubility in water | 0.003 g/100 mL mg/mL (20 °C) |
| SMILES | C1=CC(=C(C=C1Cl)CC2=C(C=CC(=C2)Cl)O)O |
Wikipedia
Chemical compound
Dichlorophen is an organochlorine compound with the formula CH2(C6H3 Cl)2. In terms of molecular structure, it consists of two 4-chlorophenol groups linked by a methylene.