WikipediaCAS 7585-39-9
Live English Wikipedia chembox and article.
Wikipedia chembox
| Names | |
|---|---|
| IUPAC name | Cyclomaltoheptaose |
| Systematic IUPAC name | Cycloheptakis-(1→4)-α- D -glucopyranosyl |
| Other names | Cycloheptaamylose / Cycloheptadextrin / Cyclomaltoheptose / β-Cycloamylose / Schardinger β-Dextrin / Betadex |
| Identifiers | |
| CAS Number | 7585-39-9 (hydrate) |
| ChEBI | CHEBI:495055 |
| ChEMBL | ChEMBL415690 |
| ChemSpider | 10469496 |
| DrugBank | DB03995 |
| EC Number | 233-007-4 |
| E number | E459 (thickeners, ...) |
| KEGG | C13183 |
| PubChem CID | 444041 |
| InChI | InChI=1S/C42H70O35/c43-1-8-29-15(50)22(57)36(64-8)72-30-9(2-44)66-38(24(59)17(30)52)74-32-11(4-46)68-40(26(61)19(32)54)76-34-13(6-48)70-42(28(63)21(34)56)77-35-14(7-49)69-41(27(62)20(35)55)75-33-12(5-47)67-39(25(60)18(33)53)73-31-10(3-45)65-37(71-29)23(58)16(31)51/h8-63H,1-7H2/t8-,9-,10-,11-,12-,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23-,24-,25-,26-,27-,28-,29-,30-,31-,32-,33-,34-,35-,36-,37-,38-,39-,40-,41-,42-/m1/ |
| SMILES | C([C@@H]1[C@@H]2[C@@H]([C@H]([C@H](O1)O[C@@H]3[C@H](O[C@@H]([C@@H]([C@H]3O)O)O[C@@H]4[C@H](O[C@@H]([C@@H]([C@H]4O)O)O[C@@H]5[C@H](O[C@@H]([C@@H]([C@H]5O)O)O[C@@H]6[C@H](O[C@@H]([C@@H]([C@H]6O)O)O[C@@H]7[C@H](O[C@@H]([C@@H]([C@H]7O)O)O[C@@H]8[C@H](O[C@H](O2)[C@@H]([C@H]8O)O)CO)CO)CO)CO)CO)CO)O)O)O |
| Properties | |
| Chemical formula | C 42 H 70 O 35 |
| Molar mass | 1 134 .987 g · mol−1 |
| Appearance | White solid |
| Melting point | 501 °C (934 °F; 774 K) at fast heating rates, decomposition below 260 °C for conventional heating |
| Solubility in water | 18.5 g/L |
| standard state | Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). · Infobox references |
Wikipedia
Chemical compound
β-Cyclodextrin sometimes abbreviated as β-CD, is a heptasaccharide derived from glucose. The α- (alpha), β- (beta), and γ- (gamma) cyclodextrins correspond to six, seven, and eight glucose units, respectively. β-Cyclodextrin is the most used natural cyclodextrin in marketed medicines. The reason for this lies in the ease of its production and subsequent low price.